C26H30Si — CID 88850697
butyl-(3,5-dimethylphenyl)-(9H-fluoren-9-yl)-methylsilane (PubChem CID 88850697) has the molecular formula C26H30Si and a molecular weight of 370.61 g/mol. Its IUPAC name is butyl-(3,5-dimethylphenyl)-(9H-fluoren-9-yl)-methylsilane.
| Compound Name | butyl-(3,5-dimethylphenyl)-(9H-fluoren-9-yl)-methylsilane |
|---|---|
| PubChem CID | 88850697 |
| Molecular Formula | C26H30Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | butyl-(3,5-dimethylphenyl)-(9H-fluoren-9-yl)-methylsilane |
| SMILES | CCCC[Si](C)(c1cc(C)cc(C)c1)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H30Si/c1-5-6-15-27(4,21-17-19(2)16-20(3)18-21)26-24-13-9-7-11-22(24)23-12-8-10-14-25(23)26/h7-14,16-18,26H,5-6,15H2,1-4H3 |
| InChIKey | XEICNUOWVPBLKR-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|