C38H64O2Si2 — CID 172789288
tributyl-[[(9R,10R)-10-tributylsilyloxy-9,10-dihydrophenanthren-9-yl]oxy]silane (PubChem CID 172789288) has the molecular formula C38H64O2Si2 and a molecular weight of 609.10 g/mol. Its IUPAC name is tributyl-[[(9R,10R)-10-tributylsilyloxy-9,10-dihydrophenanthren-9-yl]oxy]silane.
| Compound Name | tributyl-[[(9R,10R)-10-tributylsilyloxy-9,10-dihydrophenanthren-9-yl]oxy]silane |
|---|---|
| PubChem CID | 172789288 |
| Molecular Formula | C38H64O2Si2 |
| Molecular Weight | 609.10 g/mol |
| Exact Mass | 608.44 |
| IUPAC Name | tributyl-[[(9R,10R)-10-tributylsilyloxy-9,10-dihydrophenanthren-9-yl]oxy]silane |
| SMILES | CCCC[Si](CCCC)(CCCC)O[C@@H]1c2ccccc2-c2ccccc2[C@H]1O[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C38H64O2Si2/c1-7-13-27-41(28-14-8-2,29-15-9-3)39-37-35-25-21-19-23-33(35)34-24-20-22-26-36(34)38(37)40-42(30-16-10-4,31-17-11-5)32-18-12-6/h19-26,37-38H,7-18,27-32H2,1-6H3/t37-,38-/m1/s1 |
| InChIKey | PILJBECMMDQIIY-XPSQVAKYSA-N |
| XLogP | 13.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.10 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|