C20H22 — CID 123231188
5-butyltetracyclo[10.4.0.02,4.06,11]hexadeca-1(16),6,8,10,12,14-hexaene (PubChem CID 123231188) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is 5-butyltetracyclo[10.4.0.02,4.06,11]hexadeca-1(16),6,8,10,12,14-hexaene.
| Compound Name | 5-butyltetracyclo[10.4.0.02,4.06,11]hexadeca-1(16),6,8,10,12,14-hexaene |
|---|---|
| PubChem CID | 123231188 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 5-butyltetracyclo[10.4.0.02,4.06,11]hexadeca-1(16),6,8,10,12,14-hexaene |
| SMILES | CCCCC1c2ccccc2-c2ccccc2C2CC12 |
| InChI | InChI=1S/C20H22/c1-2-3-8-17-15-10-5-4-9-14(15)16-11-6-7-12-18(16)20-13-19(17)20/h4-7,9-12,17,19-20H,2-3,8,13H2,1H3 |
| InChIKey | QSPVQEWWWSUZPI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |