C19H37NO4S2 — CID 88602889
ethyl (2R)-3-(heptyldisulfanyl)-2-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate (PubChem CID 88602889) has the molecular formula C19H37NO4S2 and a molecular weight of 407.64 g/mol. Its IUPAC name is ethyl (2R)-3-(heptyldisulfanyl)-2-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate.
| Compound Name | ethyl (2R)-3-(heptyldisulfanyl)-2-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 88602889 |
| Molecular Formula | C19H37NO4S2 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | ethyl (2R)-3-(heptyldisulfanyl)-2-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate |
| SMILES | CCCCCCCSSC[C@H](NC(C)C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C19H37NO4S2/c1-7-9-10-11-12-13-25-26-14-16(18(22)23-8-2)20-15(3)17(21)24-19(4,5)6/h15-16,20H,7-14H2,1-6H3/t15?,16-/m0/s1 |
| InChIKey | YXSVKVJBHADHNL-LYKKTTPLSA-N |
| XLogP | 4.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|