About [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate
[dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate (PubChem CID 88602954) has the molecular formula C11H27NO2Si2
and a molecular weight of 261.51 g/mol. Its IUPAC name is [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate |
| PubChem CID | 88602954 |
| Molecular Formula | C11H27NO2Si2 |
| Molecular Weight | 261.51 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C[Si](C)(C)N[Si](C)(C)C |
| InChI | InChI=1S/C6H19NSi2.C5H8O2/c1-8(2,3)7-9(4,5)6;1-4(2)5(6)7-3/h7H,1-6H3;1H2,2-3H3 |
| InChIKey | RZPDCSKLKHWRHB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate?
The IUPAC name of [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate (CID 88602954) is [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate.
What is the SMILES notation for [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate?
The canonical SMILES for [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C[Si](C)(C)N[Si](C)(C)C.
What is the InChIKey of [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate?
The InChIKey is RZPDCSKLKHWRHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19NSi2.C5H8O2/c1-8(2,3)7-9(4,5)6;1-4(2)5(6)7-3/h7H,1-6H3;1H2,2-3H3.
What are the key properties of [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate?
[dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate has a molecular weight of 261.51 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl-(trimethylsilylamino)silyl]methane;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 88602954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).