C10H20O5 — CID 88610477
2-butoxy-3,5-dihydroxyhexanoic acid (PubChem CID 88610477) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-butoxy-3,5-dihydroxyhexanoic acid.
| Compound Name | 2-butoxy-3,5-dihydroxyhexanoic acid |
|---|---|
| PubChem CID | 88610477 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-butoxy-3,5-dihydroxyhexanoic acid |
| SMILES | CCCCOC(C(=O)O)C(O)CC(C)O |
| InChI | InChI=1S/C10H20O5/c1-3-4-5-15-9(10(13)14)8(12)6-7(2)11/h7-9,11-12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | UMSUXDXKTUCYSK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|