C9H18N3O4PS3 — CID 88618034
methyl (1E)-N-[[methyl-(2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)amino]sulfanylmethylcarbamoyloxy]ethanimidothioate (PubChem CID 88618034) has the molecular formula C9H18N3O4PS3 and a molecular weight of 359.44 g/mol. Its IUPAC name is methyl (1E)-N-[[methyl-(2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)amino]sulfanylmethylcarbamoyloxy]ethanimidothioate.
| Compound Name | methyl (1E)-N-[[methyl-(2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)amino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
|---|---|
| PubChem CID | 88618034 |
| Molecular Formula | C9H18N3O4PS3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | methyl (1E)-N-[[methyl-(2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)amino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
| SMILES | CS/C(C)=N/OC(=O)NCSN(C)P1(=S)OCCCO1 |
| InChI | InChI=1S/C9H18N3O4PS3/c1-8(19-3)11-16-9(13)10-7-20-12(2)17(18)14-5-4-6-15-17/h4-7H2,1-3H3,(H,10,13)/b11-8+ |
| InChIKey | PZMWQNVHRKYXMS-DHZHZOJOSA-N |
| XLogP | 2.61 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|