C25H38N2O10 — CID 88633380
[1-[[1-[carboxy(ethoxy)amino]-2-prop-2-enoyloxycyclohexyl]methyl]-2-prop-2-enoyloxycyclohexyl]-ethoxycarbamic acid (PubChem CID 88633380) has the molecular formula C25H38N2O10 and a molecular weight of 526.58 g/mol. Its IUPAC name is [1-[[1-[carboxy(ethoxy)amino]-2-prop-2-enoyloxycyclohexyl]methyl]-2-prop-2-enoyloxycyclohexyl]-ethoxycarbamic acid.
| Compound Name | [1-[[1-[carboxy(ethoxy)amino]-2-prop-2-enoyloxycyclohexyl]methyl]-2-prop-2-enoyloxycyclohexyl]-ethoxycarbamic acid |
|---|---|
| PubChem CID | 88633380 |
| Molecular Formula | C25H38N2O10 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | [1-[[1-[carboxy(ethoxy)amino]-2-prop-2-enoyloxycyclohexyl]methyl]-2-prop-2-enoyloxycyclohexyl]-ethoxycarbamic acid |
| SMILES | C=CC(=O)OC1CCCCC1(CC1(N(OCC)C(=O)O)CCCCC1OC(=O)C=C)N(OCC)C(=O)O |
| InChI | InChI=1S/C25H38N2O10/c1-5-20(28)36-18-13-9-11-15-24(18,26(22(30)31)34-7-3)17-25(27(23(32)33)35-8-4)16-12-10-14-19(25)37-21(29)6-2/h5-6,18-19H,1-2,7-17H2,3-4H3,(H,30,31)(H,32,33) |
| InChIKey | WWOKMMCEGZAYHU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|