C8H14NO2+ — CID 88634113
2,3-dioxopent-4-enyl(trimethyl)azanium (PubChem CID 88634113) has the molecular formula C8H14NO2+ and a molecular weight of 156.20 g/mol. Its IUPAC name is 2,3-dioxopent-4-enyl(trimethyl)azanium.
| Compound Name | 2,3-dioxopent-4-enyl(trimethyl)azanium |
|---|---|
| PubChem CID | 88634113 |
| Molecular Formula | C8H14NO2+ |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2,3-dioxopent-4-enyl(trimethyl)azanium |
| SMILES | C=CC(=O)C(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C8H14NO2/c1-5-7(10)8(11)6-9(2,3)4/h5H,1,6H2,2-4H3/q+1 |
| InChIKey | ZEJLBJINNKWBPG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|