C6H15NO8P2S — CID 88634579
[amino-(1,1-dioxothian-4-yl)-phosphonomethyl]phosphonic acid (PubChem CID 88634579) has the molecular formula C6H15NO8P2S and a molecular weight of 323.20 g/mol. Its IUPAC name is [amino-(1,1-dioxothian-4-yl)-phosphonomethyl]phosphonic acid.
| Compound Name | [amino-(1,1-dioxothian-4-yl)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 88634579 |
| Molecular Formula | C6H15NO8P2S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | [amino-(1,1-dioxothian-4-yl)-phosphonomethyl]phosphonic acid |
| SMILES | NC(C1CCS(=O)(=O)CC1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H15NO8P2S/c7-6(16(8,9)10,17(11,12)13)5-1-3-18(14,15)4-2-5/h5H,1-4,7H2,(H2,8,9,10)(H2,11,12,13) |
| InChIKey | BAQQRRLRSHUXLU-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|