C20H28N4O5S2 — CID 88634672
(2S,5R,6R)-6-[3-[(2R,4R)-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxycyclohexyl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88634672) has the molecular formula C20H28N4O5S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is (2S,5R,6R)-6-[3-[(2R,4R)-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxycyclohexyl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[3-[(2R,4R)-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxycyclohexyl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88634672 |
| Molecular Formula | C20H28N4O5S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (2S,5R,6R)-6-[3-[(2R,4R)-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxycyclohexyl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)CCC3CC[C@@H](O)C[C@H]3c3csc(N)n3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C20H28N4O5S2/c1-20(2)15(18(28)29)24-16(27)14(17(24)31-20)23-13(26)6-4-9-3-5-10(25)7-11(9)12-8-30-19(21)22-12/h8-11,14-15,17,25H,3-7H2,1-2H3,(H2,21,22)(H,23,26)(H,28,29)/t9?,10-,11-,14-,15+,17-/m1/s1 |
| InChIKey | LCPKCVLMZIMMKS-NLJGRNJMSA-N |
| XLogP | 1.38 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |