C18H24N4O4S3 — CID 22844769
(2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(thiolan-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 22844769) has the molecular formula C18H24N4O4S3 and a molecular weight of 456.62 g/mol. Its IUPAC name is (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(thiolan-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(thiolan-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 22844769 |
| Molecular Formula | C18H24N4O4S3 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(thiolan-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(CC3CCSC3)c3csc(N)n3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C18H24N4O4S3/c1-18(2)12(16(25)26)22-14(24)11(15(22)29-18)21-13(23)9(5-8-3-4-27-6-8)10-7-28-17(19)20-10/h7-9,11-12,15H,3-6H2,1-2H3,(H2,19,20)(H,21,23)(H,25,26)/t8?,9?,11-,12+,15-/m1/s1 |
| InChIKey | GSUCGUHQFHDSIL-HNNZCIHQSA-N |
| XLogP | 1.58 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |