C20H25N4NaO5S2 — CID 88523739
sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(7-oxabicyclo[2.2.1]heptan-2-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88523739) has the molecular formula C20H25N4NaO5S2 and a molecular weight of 488.57 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(7-oxabicyclo[2.2.1]heptan-2-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(7-oxabicyclo[2.2.1]heptan-2-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88523739 |
| Molecular Formula | C20H25N4NaO5S2 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(7-oxabicyclo[2.2.1]heptan-2-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(CC3CC4CCC3O4)c3csc(N)n3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H26N4O5S2.Na/c1-20(2)14(18(27)28)24-16(26)13(17(24)31-20)23-15(25)10(11-7-30-19(21)22-11)6-8-5-9-3-4-12(8)29-9;/h7-10,12-14,17H,3-6H2,1-2H3,(H2,21,22)(H,23,25)(H,27,28);/q;+1/p-1/t8?,9?,10?,12?,13-,14+,17-;/m1./s1 |
| InChIKey | MAQJZRYIDYHQOY-MXHCZDFZSA-M |
| XLogP | -2.93 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |