C18H23N4NaO5S3 — CID 88611697
sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(oxathian-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88611697) has the molecular formula C18H23N4NaO5S3 and a molecular weight of 494.60 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(oxathian-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(oxathian-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88611697 |
| Molecular Formula | C18H23N4NaO5S3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | sodium (2S,5R,6R)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(oxathian-3-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(CC3CCCOS3)c3csc(N)n3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H24N4O5S3.Na/c1-18(2)12(16(25)26)22-14(24)11(15(22)29-18)21-13(23)9(10-7-28-17(19)20-10)6-8-4-3-5-27-30-8;/h7-9,11-12,15H,3-6H2,1-2H3,(H2,19,20)(H,21,23)(H,25,26);/q;+1/p-1/t8?,9?,11-,12+,15-;/m1./s1 |
| InChIKey | CHTOXDVFERTDDE-WSUGBVLASA-M |
| XLogP | -2.67 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|