C15H27NO5 — CID 88634726
(E,2R,3S,4S)-3-hydroxy-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]oct-6-enoic acid (PubChem CID 88634726) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is (E,2R,3S,4S)-3-hydroxy-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]oct-6-enoic acid.
| Compound Name | (E,2R,3S,4S)-3-hydroxy-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]oct-6-enoic acid |
|---|---|
| PubChem CID | 88634726 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (E,2R,3S,4S)-3-hydroxy-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]oct-6-enoic acid |
| SMILES | C/C=C/C[C@H](C)[C@H](O)[C@@H](NCC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H27NO5/c1-6-7-8-10(2)13(18)12(14(19)20)16-9-11(17)21-15(3,4)5/h6-7,10,12-13,16,18H,8-9H2,1-5H3,(H,19,20)/b7-6+/t10-,12+,13-/m0/s1 |
| InChIKey | OFOKHBVAFDNWBF-AOLDVRMKSA-N |
| XLogP | 1.33 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|