C12H21NO4S — CID 141027506
(2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-sulfanylhex-5-enoic acid (PubChem CID 141027506) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-sulfanylhex-5-enoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-sulfanylhex-5-enoic acid |
|---|---|
| PubChem CID | 141027506 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-sulfanylhex-5-enoic acid |
| SMILES | C[C@@H](CC=CS)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H21NO4S/c1-8(6-5-7-18)9(10(14)15)13-11(16)17-12(2,3)4/h5,7-9,18H,6H2,1-4H3,(H,13,16)(H,14,15)/t8-,9-/m0/s1 |
| InChIKey | FTNUZOIRKWDYOJ-IUCAKERBSA-N |
| XLogP | 2.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|