C24H20O5PRh+ — CID 88635209
2,4-dioxopentanoyloxy(triphenyl)phosphanium;methanone;rhodium(2+) (PubChem CID 88635209) has the molecular formula C24H20O5PRh+ and a molecular weight of 522.30 g/mol. Its IUPAC name is 2,4-dioxopentanoyloxy(triphenyl)phosphanium;methanone;rhodium(2+).
| Compound Name | 2,4-dioxopentanoyloxy(triphenyl)phosphanium;methanone;rhodium(2+) |
|---|---|
| PubChem CID | 88635209 |
| Molecular Formula | C24H20O5PRh+ |
| Molecular Weight | 522.30 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 2,4-dioxopentanoyloxy(triphenyl)phosphanium;methanone;rhodium(2+) |
| SMILES | [CH-]=O.[CH2-]C(=O)CC(=O)C(=O)O[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Rh+2] |
| InChI | InChI=1S/C23H19O4P.CHO.Rh/c1-18(24)17-22(25)23(26)27-28(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;1-2;/h2-16H,1,17H2;1H;/q;-1;+2 |
| InChIKey | ALKHXBASBFKCRO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|