C23H20O4P+ — CID 88635210
2,4-dioxopentanoyloxy(triphenyl)phosphanium (PubChem CID 88635210) has the molecular formula C23H20O4P+ and a molecular weight of 391.38 g/mol. Its IUPAC name is 2,4-dioxopentanoyloxy(triphenyl)phosphanium.
| Compound Name | 2,4-dioxopentanoyloxy(triphenyl)phosphanium |
|---|---|
| PubChem CID | 88635210 |
| Molecular Formula | C23H20O4P+ |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2,4-dioxopentanoyloxy(triphenyl)phosphanium |
| SMILES | CC(=O)CC(=O)C(=O)O[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O4P/c1-18(24)17-22(25)23(26)27-28(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16H,17H2,1H3/q+1 |
| InChIKey | QVNLQEXFSNJQQP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|