C24H23N2O2S+ — CID 8864831
(3-methoxycarbonyl-4-methylquinolin-2-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 8864831) has the molecular formula C24H23N2O2S+ and a molecular weight of 403.53 g/mol. Its IUPAC name is (3-methoxycarbonyl-4-methylquinolin-2-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | (3-methoxycarbonyl-4-methylquinolin-2-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8864831 |
| Molecular Formula | C24H23N2O2S+ |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (3-methoxycarbonyl-4-methylquinolin-2-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | COC(=O)c1c(C[NH2+][C@@H](c2ccccc2)c2cccs2)nc2ccccc2c1C |
| InChI | InChI=1S/C24H22N2O2S/c1-16-18-11-6-7-12-19(18)26-20(22(16)24(27)28-2)15-25-23(21-13-8-14-29-21)17-9-4-3-5-10-17/h3-14,23,25H,15H2,1-2H3/p+1/t23-/m0/s1 |
| InChIKey | XAYXGVBNWGFEJP-QHCPKHFHSA-O |
| XLogP | 4.24 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |