C14H19NO5 — CID 88660508
ethene;ethyl N-(2-formyl-3,4-dimethoxyphenyl)carbamate (PubChem CID 88660508) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethene;ethyl N-(2-formyl-3,4-dimethoxyphenyl)carbamate.
| Compound Name | ethene;ethyl N-(2-formyl-3,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 88660508 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | ethene;ethyl N-(2-formyl-3,4-dimethoxyphenyl)carbamate |
| SMILES | C=C.CCOC(=O)Nc1ccc(OC)c(OC)c1C=O |
| InChI | InChI=1S/C12H15NO5.C2H4/c1-4-18-12(15)13-9-5-6-10(16-2)11(17-3)8(9)7-14;1-2/h5-7H,4H2,1-3H3,(H,13,15);1-2H2 |
| InChIKey | FFFDNFIYVFHHDH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|