C23H23N5O2S — CID 88660766
3-[methyl(pyridin-3-yl)amino]-4-[3-[pyridin-2-yl(thiophen-2-ylmethyl)amino]propylamino]cyclobut-3-ene-1,2-dione (PubChem CID 88660766) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 3-[methyl(pyridin-3-yl)amino]-4-[3-[pyridin-2-yl(thiophen-2-ylmethyl)amino]propylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[methyl(pyridin-3-yl)amino]-4-[3-[pyridin-2-yl(thiophen-2-ylmethyl)amino]propylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 88660766 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-[methyl(pyridin-3-yl)amino]-4-[3-[pyridin-2-yl(thiophen-2-ylmethyl)amino]propylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CN(c1cccnc1)c1c(NCCCN(Cc2cccs2)c2ccccn2)c(=O)c1=O |
| InChI | InChI=1S/C23H23N5O2S/c1-27(17-7-4-10-24-15-17)21-20(22(29)23(21)30)26-12-6-13-28(16-18-8-5-14-31-18)19-9-2-3-11-25-19/h2-5,7-11,14-15,26H,6,12-13,16H2,1H3 |
| InChIKey | FBSBLWBOFHEWBW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|