C14H19IN4S2 — CID 173388062
methyl N'-[2-[pyridin-2-yl(thiophen-2-ylmethyl)amino]ethyl]carbamimidothioate;hydroiodide (PubChem CID 173388062) has the molecular formula C14H19IN4S2 and a molecular weight of 434.37 g/mol. Its IUPAC name is methyl N'-[2-[pyridin-2-yl(thiophen-2-ylmethyl)amino]ethyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-[2-[pyridin-2-yl(thiophen-2-ylmethyl)amino]ethyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 173388062 |
| Molecular Formula | C14H19IN4S2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | methyl N'-[2-[pyridin-2-yl(thiophen-2-ylmethyl)amino]ethyl]carbamimidothioate;hydroiodide |
| SMILES | CS/C(N)=N\CCN(Cc1cccs1)c1ccccn1.I |
| InChI | InChI=1S/C14H18N4S2.HI/c1-19-14(15)17-8-9-18(11-12-5-4-10-20-12)13-6-2-3-7-16-13;/h2-7,10H,8-9,11H2,1H3,(H2,15,17);1H |
| InChIKey | HQXHIFDYBPICJH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|