C16H21N3S — CID 23882701
N-(2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine (PubChem CID 23882701) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 23882701 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine |
| SMILES | c1ccc(N(CCN2CCCC2)Cc2cccs2)nc1 |
| InChI | InChI=1S/C16H21N3S/c1-2-8-17-16(7-1)19(14-15-6-5-13-20-15)12-11-18-9-3-4-10-18/h1-2,5-8,13H,3-4,9-12,14H2 |
| InChIKey | TZPJNADIQAPSCI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |