C22H24N6OS2 — CID 135986130
N-[3-[(4-benzylimino-1-oxido-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]propyl]-N-(thiophen-2-ylmethyl)pyridin-2-amine (PubChem CID 135986130) has the molecular formula C22H24N6OS2 and a molecular weight of 452.61 g/mol. Its IUPAC name is N-[3-[(4-benzylimino-1-oxido-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]propyl]-N-(thiophen-2-ylmethyl)pyridin-2-amine.
| Compound Name | N-[3-[(4-benzylimino-1-oxido-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]propyl]-N-(thiophen-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 135986130 |
| Molecular Formula | C22H24N6OS2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[3-[(4-benzylimino-1-oxido-1,2,5-thiadiazolidin-1-ium-3-ylidene)amino]propyl]-N-(thiophen-2-ylmethyl)pyridin-2-amine |
| SMILES | [O-][s+]1[nH]c(=N\CCCN(Cc2cccs2)c2ccccn2)/c(=N/Cc2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H24N6OS2/c29-31-26-21(22(27-31)25-16-18-8-2-1-3-9-18)24-13-7-14-28(17-19-10-6-15-30-19)20-11-4-5-12-23-20/h1-6,8-12,15H,7,13-14,16-17H2,(H,24,26)(H,25,27) |
| InChIKey | BEXNIGHQEWEFKW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|