C13H22I2N2O5 — CID 88665635
2-[bis(1-hydroxy-1-iodopropyl)carbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 88665635) has the molecular formula C13H22I2N2O5 and a molecular weight of 540.14 g/mol. Its IUPAC name is 2-[bis(1-hydroxy-1-iodopropyl)carbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[bis(1-hydroxy-1-iodopropyl)carbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88665635 |
| Molecular Formula | C13H22I2N2O5 |
| Molecular Weight | 540.14 g/mol |
| Exact Mass | 539.96 |
| IUPAC Name | 2-[bis(1-hydroxy-1-iodopropyl)carbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)N(C(O)(I)CC)C(O)(I)CC |
| InChI | InChI=1S/C13H22I2N2O5/c1-5-12(14,20)17(13(15,21)6-2)11(19)16-7-8-22-10(18)9(3)4/h20-21H,3,5-8H2,1-2,4H3,(H,16,19) |
| InChIKey | TYSJEHXZFVYXGJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.14 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|