C14H22N2O5S — CID 88669062
(2S)-6-amino-2-[(2-phenyl-2-sulfoethyl)amino]hexanoic acid (PubChem CID 88669062) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is (2S)-6-amino-2-[(2-phenyl-2-sulfoethyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(2-phenyl-2-sulfoethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 88669062 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2S)-6-amino-2-[(2-phenyl-2-sulfoethyl)amino]hexanoic acid |
| SMILES | NCCCC[C@H](NCC(c1ccccc1)S(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22N2O5S/c15-9-5-4-8-12(14(17)18)16-10-13(22(19,20)21)11-6-2-1-3-7-11/h1-3,6-7,12-13,16H,4-5,8-10,15H2,(H,17,18)(H,19,20,21)/t12-,13?/m0/s1 |
| InChIKey | BAPHXKXDVZNAPN-UEWDXFNNSA-N |
| XLogP | 0.79 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|