C14H20N2O5 — CID 87949671
(2R)-6-amino-2-[[carboxy(phenyl)methoxy]amino]hexanoic acid (PubChem CID 87949671) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2R)-6-amino-2-[[carboxy(phenyl)methoxy]amino]hexanoic acid.
| Compound Name | (2R)-6-amino-2-[[carboxy(phenyl)methoxy]amino]hexanoic acid |
|---|---|
| PubChem CID | 87949671 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2R)-6-amino-2-[[carboxy(phenyl)methoxy]amino]hexanoic acid |
| SMILES | NCCCC[C@@H](NOC(C(=O)O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O5/c15-9-5-4-8-11(13(17)18)16-21-12(14(19)20)10-6-2-1-3-7-10/h1-3,6-7,11-12,16H,4-5,8-9,15H2,(H,17,18)(H,19,20)/t11-,12?/m1/s1 |
| InChIKey | VCIIIXFBPJDJAH-JHJMLUEUSA-N |
| XLogP | 0.92 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|