About dibromopalladium;triphenylphosphane
dibromopalladium;triphenylphosphane (PubChem CID 88669209) has the molecular formula C18H15Br2PPd
and a molecular weight of 528.52 g/mol. Its IUPAC name is dibromopalladium;triphenylphosphane.
Molecular Properties
| Compound Name | dibromopalladium;triphenylphosphane |
| PubChem CID | 88669209 |
| Molecular Formula | C18H15Br2PPd |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 525.83 |
| IUPAC Name | dibromopalladium;triphenylphosphane |
| SMILES | Br[Pd]Br.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2BrH.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;2*1H;/q;;;+2/p-2 |
| InChIKey | YFSFDFFPECZXJR-UHFFFAOYSA-L |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibromopalladium;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromopalladium;triphenylphosphane?
The IUPAC name of dibromopalladium;triphenylphosphane (CID 88669209) is dibromopalladium;triphenylphosphane.
What is the SMILES notation for dibromopalladium;triphenylphosphane?
The canonical SMILES for dibromopalladium;triphenylphosphane is Br[Pd]Br.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dibromopalladium;triphenylphosphane?
The InChIKey is YFSFDFFPECZXJR-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15P.2BrH.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;2*1H;/q;;;+2/p-2.
What are the key properties of dibromopalladium;triphenylphosphane?
dibromopalladium;triphenylphosphane has a molecular weight of 528.52 g/mol, XLogP of 5.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromopalladium;triphenylphosphane is sourced from PubChem (CID 88669209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).