C9H11AuO2 — CID 88672185
gold(1+);2-phenylpropane-1,2-diol (PubChem CID 88672185) has the molecular formula C9H11AuO2 and a molecular weight of 348.15 g/mol. Its IUPAC name is gold(1+);2-phenylpropane-1,2-diol.
| Compound Name | gold(1+);2-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 88672185 |
| Molecular Formula | C9H11AuO2 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | gold(1+);2-phenylpropane-1,2-diol |
| SMILES | [Au+].[CH2-]C(O)(CO)c1ccccc1 |
| InChI | InChI=1S/C9H11O2.Au/c1-9(11,7-10)8-5-3-2-4-6-8;/h2-6,10-11H,1,7H2;/q-1;+1 |
| InChIKey | KIGHMYBKRCGAMG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|