C20H26N2O5S — CID 88673614
5-[2-[2-(2-ethoxyphenoxy)ethylimino]propyl]-2-methoxybenzenesulfonamide (PubChem CID 88673614) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 5-[2-[2-(2-ethoxyphenoxy)ethylimino]propyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[2-[2-(2-ethoxyphenoxy)ethylimino]propyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 88673614 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 5-[2-[2-(2-ethoxyphenoxy)ethylimino]propyl]-2-methoxybenzenesulfonamide |
| SMILES | CCOc1ccccc1OCC/N=C(\C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H26N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14H,4,11-13H2,1-3H3,(H2,21,23,24)/b22-15+ |
| InChIKey | UZJCQEZSELWOMH-PXLXIMEGSA-N |
| XLogP | 2.82 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|