C20H27AsNO5S — CID 87816441
CID 87816441 (PubChem CID 87816441) has the molecular formula C20H27AsNO5S and a molecular weight of 468.43 g/mol.
| Compound Name | CID 87816441 |
|---|---|
| PubChem CID | 87816441 |
| Molecular Formula | C20H27AsNO5S |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | — |
| SMILES | CCOc1ccccc1OCC[As]C(C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H27AsNO5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-21-15(2)13-16-9-10-19(25-3)20(14-16)28(22,23)24/h5-10,14-15H,4,11-13H2,1-3H3,(H2,22,23,24) |
| InChIKey | FYYBRDCHFLEMGC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|