C25H36N2O3S — CID 88674753
(Z)-7-[3-[2-[(4-methoxyphenyl)carbamothioylamino]propyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 88674753) has the molecular formula C25H36N2O3S and a molecular weight of 444.64 g/mol. Its IUPAC name is (Z)-7-[3-[2-[(4-methoxyphenyl)carbamothioylamino]propyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[3-[2-[(4-methoxyphenyl)carbamothioylamino]propyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88674753 |
| Molecular Formula | C25H36N2O3S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (Z)-7-[3-[2-[(4-methoxyphenyl)carbamothioylamino]propyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | COc1ccc(NC(=S)NC(C)CC2C3CCC(C3)C2C/C=C\CCCC(=O)O)cc1 |
| InChI | InChI=1S/C25H36N2O3S/c1-17(26-25(31)27-20-11-13-21(30-2)14-12-20)15-23-19-10-9-18(16-19)22(23)7-5-3-4-6-8-24(28)29/h3,5,11-14,17-19,22-23H,4,6-10,15-16H2,1-2H3,(H,28,29)(H2,26,27,31)/b5-3- |
| InChIKey | WIUMSDZJEGCYCI-HYXAFXHYSA-N |
| XLogP | 5.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|