C14H15NO4S — CID 88675022
3-(1H-indol-3-yl)-2-(3-sulfanylpropanoyloxy)propanoic acid (PubChem CID 88675022) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-(3-sulfanylpropanoyloxy)propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-(3-sulfanylpropanoyloxy)propanoic acid |
|---|---|
| PubChem CID | 88675022 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-(3-sulfanylpropanoyloxy)propanoic acid |
| SMILES | O=C(CCS)OC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H15NO4S/c16-13(5-6-20)19-12(14(17)18)7-9-8-15-11-4-2-1-3-10(9)11/h1-4,8,12,15,20H,5-7H2,(H,17,18) |
| InChIKey | PFTSVAUMUJIFEE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|