About dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite
dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite (PubChem CID 88675839) has the molecular formula C18H24Cl2O5P2
and a molecular weight of 453.24 g/mol. Its IUPAC name is dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite.
Molecular Properties
| Compound Name | dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite |
| PubChem CID | 88675839 |
| Molecular Formula | C18H24Cl2O5P2 |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite |
| SMILES | OP(O)(CCCl)(CCCl)OP(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H24Cl2O5P2/c19-11-13-27(21,22,14-12-20)25-26(23-15-17-7-3-1-4-8-17)24-16-18-9-5-2-6-10-18/h1-10,21-22H,11-16H2 |
| InChIKey | YINFLQUQCPTBKW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite?
The IUPAC name of dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite (CID 88675839) is dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite.
What is the SMILES notation for dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite?
The canonical SMILES for dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite is OP(O)(CCCl)(CCCl)OP(OCc1ccccc1)OCc1ccccc1.
What is the InChIKey of dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite?
The InChIKey is YINFLQUQCPTBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24Cl2O5P2/c19-11-13-27(21,22,14-12-20)25-26(23-15-17-7-3-1-4-8-17)24-16-18-9-5-2-6-10-18/h1-10,21-22H,11-16H2.
What are the key properties of dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite?
dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite has a molecular weight of 453.24 g/mol, XLogP of 5.42, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl [bis(2-chloroethyl)-dihydroxy-λ5-phosphanyl] phosphite is sourced from PubChem (CID 88675839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).