C24H25NO3 — CID 88680364
4-methyl-7-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propoxy]chromen-2-one (PubChem CID 88680364) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-methyl-7-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propoxy]chromen-2-one |
|---|---|
| PubChem CID | 88680364 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-methyl-7-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCCCC3CC(c4ccccc4)=CCN3)ccc12 |
| InChI | InChI=1S/C24H25NO3/c1-17-14-24(26)28-23-16-21(9-10-22(17)23)27-13-5-8-20-15-19(11-12-25-20)18-6-3-2-4-7-18/h2-4,6-7,9-11,14,16,20,25H,5,8,12-13,15H2,1H3 |
| InChIKey | QYMZWOMUTWSGCW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|