C24H25NO3 — CID 14014459
4-methyl-7-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-2-one (PubChem CID 14014459) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-methyl-7-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-2-one |
|---|---|
| PubChem CID | 14014459 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-methyl-7-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCCCN3CC=C(c4ccccc4)CC3)ccc12 |
| InChI | InChI=1S/C24H25NO3/c1-18-16-24(26)28-23-17-21(8-9-22(18)23)27-15-5-12-25-13-10-20(11-14-25)19-6-3-2-4-7-19/h2-4,6-10,16-17H,5,11-15H2,1H3 |
| InChIKey | KHCWPUMAOWXTTO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|