C12H11Cl4NO2 — CID 88682978
(1,1,3,3-tetrachloropropan-2-ylideneamino) 3-phenylpropanoate (PubChem CID 88682978) has the molecular formula C12H11Cl4NO2 and a molecular weight of 343.04 g/mol. Its IUPAC name is (1,1,3,3-tetrachloropropan-2-ylideneamino) 3-phenylpropanoate.
| Compound Name | (1,1,3,3-tetrachloropropan-2-ylideneamino) 3-phenylpropanoate |
|---|---|
| PubChem CID | 88682978 |
| Molecular Formula | C12H11Cl4NO2 |
| Molecular Weight | 343.04 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | (1,1,3,3-tetrachloropropan-2-ylideneamino) 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)ON=C(C(Cl)Cl)C(Cl)Cl |
| InChI | InChI=1S/C12H11Cl4NO2/c13-11(14)10(12(15)16)17-19-9(18)7-6-8-4-2-1-3-5-8/h1-5,11-12H,6-7H2 |
| InChIKey | HFKGJEKVSYEEMZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|