C24H29NO2 — CID 88688788
4-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-1-oxido-1-propylpiperidin-1-ium (PubChem CID 88688788) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-1-oxido-1-propylpiperidin-1-ium.
| Compound Name | 4-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-1-oxido-1-propylpiperidin-1-ium |
|---|---|
| PubChem CID | 88688788 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-1-oxido-1-propylpiperidin-1-ium |
| SMILES | CCC[N+]1([O-])CCC(C2c3ccccc3C=Cc3ccc(OC)cc32)CC1 |
| InChI | InChI=1S/C24H29NO2/c1-3-14-25(26)15-12-20(13-16-25)24-22-7-5-4-6-18(22)8-9-19-10-11-21(27-2)17-23(19)24/h4-11,17,20,24H,3,12-16H2,1-2H3 |
| InChIKey | XHRZLBMRKJPSPG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|