C8H15N3O — CID 88690914
acetonitrile;N,N-dimethylformamide;propanenitrile (PubChem CID 88690914) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is acetonitrile;N,N-dimethylformamide;propanenitrile.
| Compound Name | acetonitrile;N,N-dimethylformamide;propanenitrile |
|---|---|
| PubChem CID | 88690914 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | acetonitrile;N,N-dimethylformamide;propanenitrile |
| SMILES | CC#N.CCC#N.CN(C)C=O |
| InChI | InChI=1S/C3H7NO.C3H5N.C2H3N/c1-4(2)3-5;1-2-3-4;1-2-3/h3H,1-2H3;2H2,1H3;1H3 |
| InChIKey | BHSJTKXPXLERIO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|