C8H18N2O — CID 174809070
N,N-dimethylformamide;ethane;propanenitrile (PubChem CID 174809070) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is N,N-dimethylformamide;ethane;propanenitrile.
| Compound Name | N,N-dimethylformamide;ethane;propanenitrile |
|---|---|
| PubChem CID | 174809070 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N,N-dimethylformamide;ethane;propanenitrile |
| SMILES | CC.CCC#N.CN(C)C=O |
| InChI | InChI=1S/C3H7NO.C3H5N.C2H6/c1-4(2)3-5;1-2-3-4;1-2/h3H,1-2H3;2H2,1H3;1-2H3 |
| InChIKey | OGNNGSPUZKMTAQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|