C15H16Cl2N2OS — CID 88692644
O-ethyl 3-(2,4-dichlorophenyl)-2-(1H-imidazol-2-yl)butanethioate (PubChem CID 88692644) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is O-ethyl 3-(2,4-dichlorophenyl)-2-(1H-imidazol-2-yl)butanethioate.
| Compound Name | O-ethyl 3-(2,4-dichlorophenyl)-2-(1H-imidazol-2-yl)butanethioate |
|---|---|
| PubChem CID | 88692644 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | O-ethyl 3-(2,4-dichlorophenyl)-2-(1H-imidazol-2-yl)butanethioate |
| SMILES | CCOC(=S)C(c1ncc[nH]1)C(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2OS/c1-3-20-15(21)13(14-18-6-7-19-14)9(2)11-5-4-10(16)8-12(11)17/h4-9,13H,3H2,1-2H3,(H,18,19) |
| InChIKey | FSGSSBPAQVMFFI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|