C14H14Cl2N2O — CID 69257218
2-[1-(2,4-dichlorophenyl)-2-prop-2-enoxyethyl]-1H-imidazole (PubChem CID 69257218) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)-2-prop-2-enoxyethyl]-1H-imidazole.
| Compound Name | 2-[1-(2,4-dichlorophenyl)-2-prop-2-enoxyethyl]-1H-imidazole |
|---|---|
| PubChem CID | 69257218 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)-2-prop-2-enoxyethyl]-1H-imidazole |
| SMILES | C=CCOCC(c1ncc[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O/c1-2-7-19-9-12(14-17-5-6-18-14)11-4-3-10(15)8-13(11)16/h2-6,8,12H,1,7,9H2,(H,17,18) |
| InChIKey | DCCYNAONIPGITK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|