C28H25N5O3S — CID 88693634
(2E)-2-[(5-amino-3,4-dihydro-2H-pyrrol-4-yl)oxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 88693634) has the molecular formula C28H25N5O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is (2E)-2-[(5-amino-3,4-dihydro-2H-pyrrol-4-yl)oxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2E)-2-[(5-amino-3,4-dihydro-2H-pyrrol-4-yl)oxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 88693634 |
| Molecular Formula | C28H25N5O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (2E)-2-[(5-amino-3,4-dihydro-2H-pyrrol-4-yl)oxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | NC1=NCCC1O/N=C(/C(=O)O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H25N5O3S/c29-25-23(16-17-30-25)36-33-24(26(34)35)22-18-37-27(31-22)32-28(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18,23H,16-17H2,(H2,29,30)(H,31,32)(H,34,35)/b33-24+ |
| InChIKey | ZOYYHWABXHDLGP-IWBSIUBASA-N |
| XLogP | 4.48 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|