C19H22N2OS2 — CID 88695216
1,3-benzothiazole;4-[ethyl(2-sulfanylethyl)amino]-2-methylbenzaldehyde (PubChem CID 88695216) has the molecular formula C19H22N2OS2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1,3-benzothiazole;4-[ethyl(2-sulfanylethyl)amino]-2-methylbenzaldehyde.
| Compound Name | 1,3-benzothiazole;4-[ethyl(2-sulfanylethyl)amino]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 88695216 |
| Molecular Formula | C19H22N2OS2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1,3-benzothiazole;4-[ethyl(2-sulfanylethyl)amino]-2-methylbenzaldehyde |
| SMILES | CCN(CCS)c1ccc(C=O)c(C)c1.c1ccc2scnc2c1 |
| InChI | InChI=1S/C12H17NOS.C7H5NS/c1-3-13(6-7-15)12-5-4-11(9-14)10(2)8-12;1-2-4-7-6(3-1)8-5-9-7/h4-5,8-9,15H,3,6-7H2,1-2H3;1-5H |
| InChIKey | SXCZSHFHJQQXAA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|