C5H12N2OS — CID 88697287
1,4-diamino-2-sulfanylpentan-3-one (PubChem CID 88697287) has the molecular formula C5H12N2OS and a molecular weight of 148.23 g/mol. Its IUPAC name is 1,4-diamino-2-sulfanylpentan-3-one.
| Compound Name | 1,4-diamino-2-sulfanylpentan-3-one |
|---|---|
| PubChem CID | 88697287 |
| Molecular Formula | C5H12N2OS |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1,4-diamino-2-sulfanylpentan-3-one |
| SMILES | CC(N)C(=O)C(S)CN |
| InChI | InChI=1S/C5H12N2OS/c1-3(7)5(8)4(9)2-6/h3-4,9H,2,6-7H2,1H3 |
| InChIKey | UPCUWRFXMOPVDZ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|