C19H25N3O6S2 — CID 88702287
(6R)-7-[[(2E)-2-(2,3-dihydro-1,4-oxathiin-6-yl)-2-hexoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88702287) has the molecular formula C19H25N3O6S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(2,3-dihydro-1,4-oxathiin-6-yl)-2-hexoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(2,3-dihydro-1,4-oxathiin-6-yl)-2-hexoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88702287 |
| Molecular Formula | C19H25N3O6S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (6R)-7-[[(2E)-2-(2,3-dihydro-1,4-oxathiin-6-yl)-2-hexoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCCCCO/N=C(/C(=O)NC1C(=O)N2C(C(=O)O)=CCS[C@H]12)C1=CSCCO1 |
| InChI | InChI=1S/C19H25N3O6S2/c1-2-3-4-5-7-28-21-14(13-11-29-10-8-27-13)16(23)20-15-17(24)22-12(19(25)26)6-9-30-18(15)22/h6,11,15,18H,2-5,7-10H2,1H3,(H,20,23)(H,25,26)/b21-14+/t15?,18-/m1/s1 |
| InChIKey | YXLJETXPCJOEPX-NIEMSNMESA-N |
| XLogP | 1.91 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|