C16H22ClN3O7S — CID 131712536
(6R)-7-[(4-chloro-3,3-diethoxy-2-methoxyiminobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 131712536) has the molecular formula C16H22ClN3O7S and a molecular weight of 435.89 g/mol. Its IUPAC name is (6R)-7-[(4-chloro-3,3-diethoxy-2-methoxyiminobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[(4-chloro-3,3-diethoxy-2-methoxyiminobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 131712536 |
| Molecular Formula | C16H22ClN3O7S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (6R)-7-[(4-chloro-3,3-diethoxy-2-methoxyiminobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCOC(CCl)(OCC)C(=NOC)C(=O)NC1C(=O)N2C(C(=O)O)=CCS[C@H]12 |
| InChI | InChI=1S/C16H22ClN3O7S/c1-4-26-16(8-17,27-5-2)11(19-25-3)12(21)18-10-13(22)20-9(15(23)24)6-7-28-14(10)20/h6,10,14H,4-5,7-8H2,1-3H3,(H,18,21)(H,23,24)/t10?,14-/m1/s1 |
| InChIKey | KQQAHMWJOOUTCG-LNUXAPHWSA-N |
| XLogP | 0.37 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|