C25H41NO4 — CID 88703912
(Z)-7-[(1S,2S,3R,4R)-3-[4-(1-oxooct-2-en-4-ylamino)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 88703912) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-[4-(1-oxooct-2-en-4-ylamino)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-[4-(1-oxooct-2-en-4-ylamino)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88703912 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-[4-(1-oxooct-2-en-4-ylamino)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCC(C=CC=O)NCCCC[C@@H]1[C@H](C/C=C\CCCC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C25H41NO4/c1-2-3-11-20(12-10-19-27)26-18-9-8-14-22-21(23-16-17-24(22)30-23)13-6-4-5-7-15-25(28)29/h4,6,10,12,19-24,26H,2-3,5,7-9,11,13-18H2,1H3,(H,28,29)/b6-4-,12-10?/t20?,21-,22+,23-,24+/m0/s1 |
| InChIKey | PZZZGJJAPNMLCZ-INUFCNDQSA-N |
| XLogP | 5.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|