C38H51N3O7S — CID 88706944
benzyl 4-[(8S)-8-ethoxy-8-[[(3R)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-1-oxooct-1-en-2-yl]piperidine-1-carboxylate (PubChem CID 88706944) has the molecular formula C38H51N3O7S and a molecular weight of 693.91 g/mol. Its IUPAC name is benzyl 4-[(8S)-8-ethoxy-8-[[(3R)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-1-oxooct-1-en-2-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(8S)-8-ethoxy-8-[[(3R)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-1-oxooct-1-en-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88706944 |
| Molecular Formula | C38H51N3O7S |
| Molecular Weight | 693.91 g/mol |
| Exact Mass | 693.34 |
| IUPAC Name | benzyl 4-[(8S)-8-ethoxy-8-[[(3R)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-1-oxooct-1-en-2-yl]piperidine-1-carboxylate |
| SMILES | CCO[C@@H](CCCCCC(=C=O)C1CCN(C(=O)OCc2ccccc2)CC1)N[C@H]1CSc2ccccc2N(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C38H51N3O7S/c1-5-46-34(39-31-27-49-33-18-13-12-17-32(33)41(36(31)44)24-35(43)48-38(2,3)4)19-11-7-10-16-30(25-42)29-20-22-40(23-21-29)37(45)47-26-28-14-8-6-9-15-28/h6,8-9,12-15,17-18,29,31,34,39H,5,7,10-11,16,19-24,26-27H2,1-4H3/t31-,34-/m0/s1 |
| InChIKey | POQLCLINKLUCPR-VBTAUBHQSA-N |
| XLogP | 6.55 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.91 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|