C21H19N7O5S2 — CID 88708626
(6S)-4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88708626) has the molecular formula C21H19N7O5S2 and a molecular weight of 513.56 g/mol. Its IUPAC name is (6S)-4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6S)-4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88708626 |
| Molecular Formula | C21H19N7O5S2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | (6S)-4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1S[C@H]2CC(=O)N2C(C(=O)[O-])=C1C[n+]1cc2ccccn2c1)c1csc(N)n1 |
| InChI | InChI=1S/C21H19N7O5S2/c1-33-25-16(13-9-34-21(22)23-13)18(30)24-19-12(8-26-7-11-4-2-3-5-27(11)10-26)17(20(31)32)28-14(29)6-15(28)35-19/h2-5,7,9-10,15,19H,6,8H2,1H3,(H3-,22,23,24,30,31,32)/t15-,19?/m0/s1 |
| InChIKey | ZKXXVYIVYYWRRV-FUKCDUGKSA-N |
| XLogP | -0.93 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|